C18H23N7OS — CID 57009000
7-amino-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one (PubChem CID 57009000) has the molecular formula C18H23N7OS and a molecular weight of 385.50 g/mol. Its IUPAC name is 7-amino-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one.
| Compound Name | 7-amino-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 57009000 |
| Molecular Formula | C18H23N7OS |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 7-amino-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one |
| SMILES | Nc1ccc2c(c1)SN(CCCN1CCN(c3ncccn3)CC1)C(=O)N2 |
| InChI | InChI=1S/C18H23N7OS/c19-14-3-4-15-16(13-14)27-25(18(26)22-15)8-2-7-23-9-11-24(12-10-23)17-20-5-1-6-21-17/h1,3-6,13H,2,7-12,19H2,(H,22,26) |
| InChIKey | HMSMWQMZPPFPEE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|