C22H26N6O2 — CID 2755061
1-phenyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyridazine-3,6-dione (PubChem CID 2755061) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-phenyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyridazine-3,6-dione.
| Compound Name | 1-phenyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyridazine-3,6-dione |
|---|---|
| PubChem CID | 2755061 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-phenyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(-c2ccccc2)n1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H26N6O2/c29-20-9-10-21(30)28(19-7-2-1-3-8-19)27(20)14-5-4-13-25-15-17-26(18-16-25)22-23-11-6-12-24-22/h1-3,6-12H,4-5,13-18H2 |
| InChIKey | QOTWHDDSOMQLJW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|