C26H29N6O2+ — CID 7057257
2-phenyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)butyl]phthalazine-1,4-dione (PubChem CID 7057257) has the molecular formula C26H29N6O2+ and a molecular weight of 457.56 g/mol. Its IUPAC name is 2-phenyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)butyl]phthalazine-1,4-dione.
| Compound Name | 2-phenyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)butyl]phthalazine-1,4-dione |
|---|---|
| PubChem CID | 7057257 |
| Molecular Formula | C26H29N6O2+ |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-phenyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)butyl]phthalazine-1,4-dione |
| SMILES | O=c1c2ccccc2c(=O)n(-c2ccccc2)n1CCCC[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C26H28N6O2/c33-24-22-11-4-5-12-23(22)25(34)32(21-9-2-1-3-10-21)31(24)16-7-6-15-29-17-19-30(20-18-29)26-27-13-8-14-28-26/h1-5,8-14H,6-7,15-20H2/p+1 |
| InChIKey | ACSCSDAKHQIFAD-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|