C20H22N3O2+ — CID 8597983
2-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 8597983) has the molecular formula C20H22N3O2+ and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8597983 |
| Molecular Formula | C20H22N3O2+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O2/c24-19-17-8-4-5-9-18(17)20(25)23(19)15-12-21-10-13-22(14-11-21)16-6-2-1-3-7-16/h1-9H,10-15H2/p+1 |
| InChIKey | XJIVMDLRFJXHEY-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|