C20H22N3O3+ — CID 8690663
2-[2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 8690663) has the molecular formula C20H22N3O3+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8690663 |
| Molecular Formula | C20H22N3O3+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C20H21N3O3/c24-16-7-5-15(6-8-16)22-12-9-21(10-13-22)11-14-23-19(25)17-3-1-2-4-18(17)20(23)26/h1-8,24H,9-14H2/p+1 |
| InChIKey | MTDBVDBANOIYFR-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|