C21H21N2O2+ — CID 8554728
2-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 8554728) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8554728 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[NH+]1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H20N2O2/c24-20-18-8-4-5-9-19(18)21(25)23(20)15-14-22-12-10-17(11-13-22)16-6-2-1-3-7-16/h1-10H,11-15H2/p+1 |
| InChIKey | YSVQLLNPDYCBTG-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|