C19H25N2O2+ — CID 11930919
2-[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 11930919) has the molecular formula C19H25N2O2+ and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11930919 |
| Molecular Formula | C19H25N2O2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[NH+]1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H24N2O2/c22-18-15-8-2-3-9-16(15)19(23)21(18)13-12-20-11-5-7-14-6-1-4-10-17(14)20/h2-3,8-9,14,17H,1,4-7,10-13H2/p+1/t14-,17-/m0/s1 |
| InChIKey | VHMKRFITCWDRJK-YOEHRIQHSA-O |
| XLogP | 1.52 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|