C16H20N2O4S — CID 23005465
N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide (PubChem CID 23005465) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide.
| Compound Name | N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 23005465 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H20N2O4S/c19-15-13-8-4-5-9-14(13)16(20)18(15)10-11-23(21,22)17-12-6-2-1-3-7-12/h4-5,8-9,12,17H,1-3,6-7,10-11H2 |
| InChIKey | HUBFZOUQCVWPEJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|