C23H25N3O6S — CID 125499396
benzyl (3S)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonylamino]piperidine-1-carboxylate (PubChem CID 125499396) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is benzyl (3S)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonylamino]piperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 125499396 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | benzyl (3S)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonylamino]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H](NS(=O)(=O)CCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C23H25N3O6S/c27-21-19-10-4-5-11-20(19)22(28)26(21)13-14-33(30,31)24-18-9-6-12-25(15-18)23(29)32-16-17-7-2-1-3-8-17/h1-5,7-8,10-11,18,24H,6,9,12-16H2/t18-/m0/s1 |
| InChIKey | OGTVSHXDKVIUFK-SFHVURJKSA-N |
| XLogP | 2.00 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|