C20H22N4O4S — CID 66624402
2-(1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide (PubChem CID 66624402) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 66624402 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)NC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C20H22N4O4S/c25-19-17-3-1-2-4-18(17)20(26)24(19)13-14-29(27,28)22-15-7-11-23(12-8-15)16-5-9-21-10-6-16/h1-6,9-10,15,22H,7-8,11-14H2 |
| InChIKey | IOVRHHLQISVSOS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|