C10H11N3O4S — CID 83813899
2-(1,3-dioxoisoindol-2-yl)ethanesulfonohydrazide (PubChem CID 83813899) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethanesulfonohydrazide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethanesulfonohydrazide |
|---|---|
| PubChem CID | 83813899 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethanesulfonohydrazide |
| SMILES | NNS(=O)(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H11N3O4S/c11-12-18(16,17)6-5-13-9(14)7-3-1-2-4-8(7)10(13)15/h1-4,12H,5-6,11H2 |
| InChIKey | YRDHNRZVUPLXTN-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|