C15H21N3O4S — CID 120711592
N-(2-amino-2-methylpropyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide (PubChem CID 120711592) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide.
| Compound Name | N-(2-amino-2-methylpropyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 120711592 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide |
| SMILES | CC(C)(N)CNS(=O)(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H21N3O4S/c1-15(2,16)10-17-23(21,22)9-5-8-18-13(19)11-6-3-4-7-12(11)14(18)20/h3-4,6-7,17H,5,8-10,16H2,1-2H3 |
| InChIKey | IHGHBGAZLYLBNW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|