C22H26N2O5S — CID 97307677
3-(1,3-dioxoisoindol-2-yl)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]propane-1-sulfonamide (PubChem CID 97307677) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]propane-1-sulfonamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 97307677 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]propane-1-sulfonamide |
| SMILES | COc1ccc([C@H](NS(=O)(=O)CCCN2C(=O)c3ccccc3C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-15(2)20(16-9-11-17(29-3)12-10-16)23-30(27,28)14-6-13-24-21(25)18-7-4-5-8-19(18)22(24)26/h4-5,7-12,15,20,23H,6,13-14H2,1-3H3/t20-/m1/s1 |
| InChIKey | GWDSRZKHERIWSU-HXUWFJFHSA-N |
| XLogP | 3.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|