C39H45NO5P+ — CID 70693782
10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-methoxyphenyl)phosphanium (PubChem CID 70693782) has the molecular formula C39H45NO5P+ and a molecular weight of 638.77 g/mol. Its IUPAC name is 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-methoxyphenyl)phosphanium.
| Compound Name | 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-methoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 70693782 |
| Molecular Formula | C39H45NO5P+ |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 10-(1,3-dioxoisoindol-2-yl)decyl-tris(4-methoxyphenyl)phosphanium |
| SMILES | COc1ccc([P+](CCCCCCCCCCN2C(=O)c3ccccc3C2=O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H45NO5P/c1-43-30-16-22-33(23-17-30)46(34-24-18-31(44-2)19-25-34,35-26-20-32(45-3)21-27-35)29-13-9-7-5-4-6-8-12-28-40-38(41)36-14-10-11-15-37(36)39(40)42/h10-11,14-27H,4-9,12-13,28-29H2,1-3H3/q+1 |
| InChIKey | DMTJYZSNDKGYOD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|