C21H23N3O5 — CID 108889568
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]urea (PubChem CID 108889568) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 108889568 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(OCCNC(=O)NCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-28-15-7-9-16(10-8-15)29-14-12-23-21(27)22-11-4-13-24-19(25)17-5-2-3-6-18(17)20(24)26/h2-3,5-10H,4,11-14H2,1H3,(H2,22,23,27) |
| InChIKey | CQGGJHYAMTVRFC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|