C18H26ClN3O4S — CID 120720602
3-(1,3-dioxoisoindol-2-yl)-N-[(4-methylpiperidin-4-yl)methyl]propane-1-sulfonamide;hydrochloride (PubChem CID 120720602) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methylpiperidin-4-yl)methyl]propane-1-sulfonamide;hydrochloride.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methylpiperidin-4-yl)methyl]propane-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120720602 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methylpiperidin-4-yl)methyl]propane-1-sulfonamide;hydrochloride |
| SMILES | CC1(CNS(=O)(=O)CCCN2C(=O)c3ccccc3C2=O)CCNCC1.Cl |
| InChI | InChI=1S/C18H25N3O4S.ClH/c1-18(7-9-19-10-8-18)13-20-26(24,25)12-4-11-21-16(22)14-5-2-3-6-15(14)17(21)23;/h2-3,5-6,19-20H,4,7-13H2,1H3;1H |
| InChIKey | OWXOUUWPZMGQCJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|