C18H24ClN3O4S — CID 120711835
2-[3-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)propyl]isoindole-1,3-dione;hydrochloride (PubChem CID 120711835) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[3-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)propyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[3-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)propyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 120711835 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[3-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)propyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CCCS(=O)(=O)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C18H23N3O4S.ClH/c22-17-15-4-1-2-5-16(15)18(23)21(17)9-3-11-26(24,25)20-10-8-13-6-7-14(12-20)19-13;/h1-2,4-5,13-14,19H,3,6-12H2;1H |
| InChIKey | MPASHGGMZILCFH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|