C16H20N2O4S — CID 16811271
2-[2-(3-methylpiperidin-1-yl)sulfonylethyl]isoindole-1,3-dione (PubChem CID 16811271) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[2-(3-methylpiperidin-1-yl)sulfonylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-methylpiperidin-1-yl)sulfonylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 16811271 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[2-(3-methylpiperidin-1-yl)sulfonylethyl]isoindole-1,3-dione |
| SMILES | CC1CCCN(S(=O)(=O)CCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-5-4-8-17(11-12)23(21,22)10-9-18-15(19)13-6-2-3-7-14(13)16(18)20/h2-3,6-7,12H,4-5,8-11H2,1H3 |
| InChIKey | DAKCRTPYNWVWGL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|