C15H21N3O2S — CID 41421069
1-[2-[(3R)-3-methylpiperidin-1-yl]sulfonylethyl]benzimidazole (PubChem CID 41421069) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-[2-[(3R)-3-methylpiperidin-1-yl]sulfonylethyl]benzimidazole.
| Compound Name | 1-[2-[(3R)-3-methylpiperidin-1-yl]sulfonylethyl]benzimidazole |
|---|---|
| PubChem CID | 41421069 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-[2-[(3R)-3-methylpiperidin-1-yl]sulfonylethyl]benzimidazole |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)CCn2cnc3ccccc32)C1 |
| InChI | InChI=1S/C15H21N3O2S/c1-13-5-4-8-18(11-13)21(19,20)10-9-17-12-16-14-6-2-3-7-15(14)17/h2-3,6-7,12-13H,4-5,8-11H2,1H3/t13-/m1/s1 |
| InChIKey | KVQZIZIQDHSBPH-CYBMUJFWSA-N |
| XLogP | 2.10 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |