C19H29N5 — CID 111145476
N'-[3-(benzimidazol-1-yl)propyl]-N-ethyl-3-methylpiperidine-1-carboximidamide (PubChem CID 111145476) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is N'-[3-(benzimidazol-1-yl)propyl]-N-ethyl-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(benzimidazol-1-yl)propyl]-N-ethyl-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111145476 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | N'-[3-(benzimidazol-1-yl)propyl]-N-ethyl-3-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)N1CCCC(C)C1 |
| InChI | InChI=1S/C19H29N5/c1-3-20-19(23-12-6-8-16(2)14-23)21-11-7-13-24-15-22-17-9-4-5-10-18(17)24/h4-5,9-10,15-16H,3,6-8,11-14H2,1-2H3,(H,20,21) |
| InChIKey | DQNOMHGATURBDY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|