C16H21N3O4S — CID 41421126
methyl 1-[2-(benzimidazol-1-yl)ethylsulfonyl]piperidine-4-carboxylate (PubChem CID 41421126) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is methyl 1-[2-(benzimidazol-1-yl)ethylsulfonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(benzimidazol-1-yl)ethylsulfonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 41421126 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 1-[2-(benzimidazol-1-yl)ethylsulfonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)CCn2cnc3ccccc32)CC1 |
| InChI | InChI=1S/C16H21N3O4S/c1-23-16(20)13-6-8-19(9-7-13)24(21,22)11-10-18-12-17-14-4-2-3-5-15(14)18/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | QZJCGYSPPMLIHO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |