C15H19NO6S — CID 7961507
methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 7961507) has the molecular formula C15H19NO6S and a molecular weight of 341.38 g/mol. Its IUPAC name is methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 7961507 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H19NO6S/c1-21-14(17)11-7-9-16(10-8-11)23(19,20)13-6-4-3-5-12(13)15(18)22-2/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | FFQCXJYFMGOTMJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |