C20H30N2O5S — CID 43007840
methyl 2-[4-(hexylcarbamoyl)piperidin-1-yl]sulfonylbenzoate (PubChem CID 43007840) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is methyl 2-[4-(hexylcarbamoyl)piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-[4-(hexylcarbamoyl)piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 43007840 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | methyl 2-[4-(hexylcarbamoyl)piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCCCCCNC(=O)C1CCN(S(=O)(=O)c2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C20H30N2O5S/c1-3-4-5-8-13-21-19(23)16-11-14-22(15-12-16)28(25,26)18-10-7-6-9-17(18)20(24)27-2/h6-7,9-10,16H,3-5,8,11-15H2,1-2H3,(H,21,23) |
| InChIKey | KHMLYPHZJZGHRW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|