C22H30N2O3S — CID 32645883
N-hexyl-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 32645883) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-hexyl-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-hexyl-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 32645883 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-hexyl-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCCCCCNC(=O)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H30N2O3S/c1-2-3-4-7-14-23-22(25)19-12-15-24(16-13-19)28(26,27)21-11-10-18-8-5-6-9-20(18)17-21/h5-6,8-11,17,19H,2-4,7,12-16H2,1H3,(H,23,25) |
| InChIKey | HWBZDZSCRAFJLD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|