C26H29FN2O4S — CID 42572161
N-[4-(4-fluorophenoxy)butyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 42572161) has the molecular formula C26H29FN2O4S and a molecular weight of 484.59 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 42572161 |
| Molecular Formula | C26H29FN2O4S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C26H29FN2O4S/c27-23-8-10-24(11-9-23)33-18-4-3-15-28-26(30)21-13-16-29(17-14-21)34(31,32)25-12-7-20-5-1-2-6-22(20)19-25/h1-2,5-12,19,21H,3-4,13-18H2,(H,28,30) |
| InChIKey | BMYGXESEZJTSJL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|