C24H29FN2O6S — CID 42572131
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[4-(4-fluorophenoxy)butyl]piperidine-4-carboxamide (PubChem CID 42572131) has the molecular formula C24H29FN2O6S and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[4-(4-fluorophenoxy)butyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[4-(4-fluorophenoxy)butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42572131 |
| Molecular Formula | C24H29FN2O6S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[4-(4-fluorophenoxy)butyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C24H29FN2O6S/c25-19-3-5-20(6-4-19)31-14-2-1-11-26-24(28)18-9-12-27(13-10-18)34(29,30)21-7-8-22-23(17-21)33-16-15-32-22/h3-8,17-18H,1-2,9-16H2,(H,26,28) |
| InChIKey | QLVUGHICSUBCCR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|