C24H38N2O5S — CID 36618614
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-(7-methyloctyl)piperidine-4-carboxamide (PubChem CID 36618614) has the molecular formula C24H38N2O5S and a molecular weight of 466.64 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-(7-methyloctyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-(7-methyloctyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 36618614 |
| Molecular Formula | C24H38N2O5S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-(7-methyloctyl)piperidine-4-carboxamide |
| SMILES | CC(C)CCCCCCNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C24H38N2O5S/c1-19(2)8-5-3-4-6-13-25-24(27)20-11-14-26(15-12-20)32(28,29)21-9-10-22-23(18-21)31-17-7-16-30-22/h9-10,18-20H,3-8,11-17H2,1-2H3,(H,25,27) |
| InChIKey | JUPINPFEZVZJSV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|