C23H36N2O5S — CID 55376278
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-octan-2-ylpiperidine-4-carboxamide (PubChem CID 55376278) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-octan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-octan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55376278 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-N-octan-2-ylpiperidine-4-carboxamide |
| SMILES | CCCCCCC(C)NC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCCO3)CC1 |
| InChI | InChI=1S/C23H36N2O5S/c1-3-4-5-6-8-18(2)24-23(26)19-11-13-25(14-12-19)31(27,28)20-9-10-21-22(17-20)30-16-7-15-29-21/h9-10,17-19H,3-8,11-16H2,1-2H3,(H,24,26) |
| InChIKey | WICFWDDSEQBEIZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|