C18H27N3O5S — CID 119432096
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[3-(methylamino)propyl]piperidine-4-carboxamide (PubChem CID 119432096) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[3-(methylamino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[3-(methylamino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119432096 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[3-(methylamino)propyl]piperidine-4-carboxamide |
| SMILES | CNCCCNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-19-7-2-8-20-18(22)14-5-9-21(10-6-14)27(23,24)15-3-4-16-17(13-15)26-12-11-25-16/h3-4,13-14,19H,2,5-12H2,1H3,(H,20,22) |
| InChIKey | WKLYJFYZTRTRFN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|