C18H30ClN3O3S — CID 119430619
1-(3,4-dimethylphenyl)sulfonyl-N-[3-(methylamino)propyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119430619) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(methylamino)propyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(methylamino)propyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119430619 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-N-[3-(methylamino)propyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-14-5-6-17(13-15(14)2)25(23,24)21-11-7-16(8-12-21)18(22)20-10-4-9-19-3;/h5-6,13,16,19H,4,7-12H2,1-3H3,(H,20,22);1H |
| InChIKey | BSVHMSGRRQMFRA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|