C20H34ClN3O3S — CID 119430053
N-[3-(methylamino)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119430053) has the molecular formula C20H34ClN3O3S and a molecular weight of 432.03 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119430053 |
| Molecular Formula | C20H34ClN3O3S |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[3-(methylamino)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C1CCN(S(=O)(=O)c2c(C)c(C)cc(C)c2C)CC1.Cl |
| InChI | InChI=1S/C20H33N3O3S.ClH/c1-14-13-15(2)17(4)19(16(14)3)27(25,26)23-11-7-18(8-12-23)20(24)22-10-6-9-21-5;/h13,18,21H,6-12H2,1-5H3,(H,22,24);1H |
| InChIKey | WUWPHNDTLCGHSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|