C19H31N3O3S — CID 119405340
N-(3-aminopropyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 119405340) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119405340 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(3-aminopropyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NCCCN)CC2)c1C |
| InChI | InChI=1S/C19H31N3O3S/c1-13-12-14(2)16(4)18(15(13)3)26(24,25)22-10-6-17(7-11-22)19(23)21-9-5-8-20/h12,17H,5-11,20H2,1-4H3,(H,21,23) |
| InChIKey | ICVJJOPLGUAXMM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|