C27H36N4O3S — CID 112767751
N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 112767751) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 112767751 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[3-(2-methylbenzimidazol-1-yl)propyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NCCCn3c(C)nc4ccccc43)CC2)c1C |
| InChI | InChI=1S/C27H36N4O3S/c1-18-17-19(2)21(4)26(20(18)3)35(33,34)30-15-11-23(12-16-30)27(32)28-13-8-14-31-22(5)29-24-9-6-7-10-25(24)31/h6-7,9-10,17,23H,8,11-16H2,1-5H3,(H,28,32) |
| InChIKey | GVYQWEUCSLFSPU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|