C18H26N4O — CID 120632096
(2S,4S)-2-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 120632096) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120632096 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S,4S)-2-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C18H26N4O/c1-13-12-15(8-10-19-13)18(23)20-9-5-11-22-14(2)21-16-6-3-4-7-17(16)22/h3-4,6-7,13,15,19H,5,8-12H2,1-2H3,(H,20,23)/t13-,15-/m0/s1 |
| InChIKey | FTWQJDIKGSIVDV-ZFWWWQNUSA-N |
| XLogP | 2.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|