C25H35N3O3S — CID 26443164
N-[[4-(dimethylamino)phenyl]methyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26443164) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26443164 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NCc3ccc(N(C)C)cc3)CC2)c1C |
| InChI | InChI=1S/C25H35N3O3S/c1-17-15-18(2)20(4)24(19(17)3)32(30,31)28-13-11-22(12-14-28)25(29)26-16-21-7-9-23(10-8-21)27(5)6/h7-10,15,22H,11-14,16H2,1-6H3,(H,26,29) |
| InChIKey | SSBAHJLYODTLEJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|