C22H28N4O3S2 — CID 55585448
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55585448) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55585448 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)NCc3cn4ccsc4n3)CC2)c1C |
| InChI | InChI=1S/C22H28N4O3S2/c1-14-11-15(2)17(4)20(16(14)3)31(28,29)26-7-5-18(6-8-26)21(27)23-12-19-13-25-9-10-30-22(25)24-19/h9-11,13,18H,5-8,12H2,1-4H3,(H,23,27) |
| InChIKey | JZFPCIUKMSDAFY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |