C17H28ClN3O3S — CID 119405837
N-(3-aminopropyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119405837) has the molecular formula C17H28ClN3O3S and a molecular weight of 389.95 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119405837 |
| Molecular Formula | C17H28ClN3O3S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-(3-aminopropyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCCN)CC2)cc1C.Cl |
| InChI | InChI=1S/C17H27N3O3S.ClH/c1-13-4-5-16(12-14(13)2)24(22,23)20-10-6-15(7-11-20)17(21)19-9-3-8-18;/h4-5,12,15H,3,6-11,18H2,1-2H3,(H,19,21);1H |
| InChIKey | JZRNOTRFHSBBQM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|