C19H30N2O4S — CID 26776108
1-(3,4-dimethylphenyl)sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 26776108) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26776108 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C19H30N2O4S/c1-4-25-13-5-10-20-19(22)17-8-11-21(12-9-17)26(23,24)18-7-6-15(2)16(3)14-18/h6-7,14,17H,4-5,8-13H2,1-3H3,(H,20,22) |
| InChIKey | IQOZNMMZWZMIGH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|