C26H38N2O3S — CID 26878686
N-[2-(1-adamantyl)ethyl]-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26878686) has the molecular formula C26H38N2O3S and a molecular weight of 458.67 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26878686 |
| Molecular Formula | C26H38N2O3S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCC34CC5CC(CC(C5)C3)C4)CC2)cc1C |
| InChI | InChI=1S/C26H38N2O3S/c1-18-3-4-24(11-19(18)2)32(30,31)28-9-5-23(6-10-28)25(29)27-8-7-26-15-20-12-21(16-26)14-22(13-20)17-26/h3-4,11,20-23H,5-10,12-17H2,1-2H3,(H,27,29) |
| InChIKey | IHUMXBBHZWDQPU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |