C23H26FNO7S — CID 31431773
3-(4-fluorophenoxy)propyl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate (PubChem CID 31431773) has the molecular formula C23H26FNO7S and a molecular weight of 479.53 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate.
| Compound Name | 3-(4-fluorophenoxy)propyl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31431773 |
| Molecular Formula | C23H26FNO7S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
| SMILES | O=C(OCCCOc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C23H26FNO7S/c24-18-2-4-19(5-3-18)29-12-1-13-32-23(26)17-8-10-25(11-9-17)33(27,28)20-6-7-21-22(16-20)31-15-14-30-21/h2-7,16-17H,1,8-15H2 |
| InChIKey | GOOVOHJJHIBATO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|