C20H27N3O4S2 — CID 124868908
2-[3-[(3R,4R)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylpropyl]isoindole-1,3-dione (PubChem CID 124868908) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[3-[(3R,4R)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(3R,4R)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 124868908 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[3-[(3R,4R)-3-methylsulfanyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]sulfonylpropyl]isoindole-1,3-dione |
| SMILES | CS[C@@H]1CN(S(=O)(=O)CCCN2C(=O)c3ccccc3C2=O)C[C@H]1N1CCCC1 |
| InChI | InChI=1S/C20H27N3O4S2/c1-28-18-14-22(13-17(18)21-9-4-5-10-21)29(26,27)12-6-11-23-19(24)15-7-2-3-8-16(15)20(23)25/h2-3,7-8,17-18H,4-6,9-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | XTJIQSKEPABWEI-QZTJIDSGSA-N |
| XLogP | 1.51 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|