C16H19N3O5S — CID 110678594
1-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]piperidine-4-carboxamide (PubChem CID 110678594) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110678594 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C16H19N3O5S/c17-14(20)11-5-7-18(8-6-11)25(23,24)10-9-19-15(21)12-3-1-2-4-13(12)16(19)22/h1-4,11H,5-10H2,(H2,17,20) |
| InChIKey | HKQDNQKOTBYYQJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|