C18H21N3O5S — CID 110346889
2-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]sulfonylethyl]isoindole-1,3-dione (PubChem CID 110346889) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]sulfonylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]sulfonylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110346889 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[2-[4-(cyclopropanecarbonyl)piperazin-1-yl]sulfonylethyl]isoindole-1,3-dione |
| SMILES | O=C(C1CC1)N1CCN(S(=O)(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C18H21N3O5S/c22-16(13-5-6-13)19-7-9-20(10-8-19)27(25,26)12-11-21-17(23)14-3-1-2-4-15(14)18(21)24/h1-4,13H,5-12H2 |
| InChIKey | ZCNHDGAYAXIBRW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|