C18H26ClN3O4S — CID 120710926
2-[3-[3-(1-aminoethyl)piperidin-1-yl]sulfonylpropyl]isoindole-1,3-dione;hydrochloride (PubChem CID 120710926) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is 2-[3-[3-(1-aminoethyl)piperidin-1-yl]sulfonylpropyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[3-[3-(1-aminoethyl)piperidin-1-yl]sulfonylpropyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 120710926 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[3-[3-(1-aminoethyl)piperidin-1-yl]sulfonylpropyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CC(N)C1CCCN(S(=O)(=O)CCCN2C(=O)c3ccccc3C2=O)C1.Cl |
| InChI | InChI=1S/C18H25N3O4S.ClH/c1-13(19)14-6-4-9-20(12-14)26(24,25)11-5-10-21-17(22)15-7-2-3-8-16(15)18(21)23;/h2-3,7-8,13-14H,4-6,9-12,19H2,1H3;1H |
| InChIKey | UGFTVBBTSSXDFD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|