C18H26ClN3O4S — CID 120713685
N-(2-amino-1-cyclopentylethyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide;hydrochloride (PubChem CID 120713685) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120713685 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide;hydrochloride |
| SMILES | Cl.NCC(NS(=O)(=O)CCCN1C(=O)c2ccccc2C1=O)C1CCCC1 |
| InChI | InChI=1S/C18H25N3O4S.ClH/c19-12-16(13-6-1-2-7-13)20-26(24,25)11-5-10-21-17(22)14-8-3-4-9-15(14)18(21)23;/h3-4,8-9,13,16,20H,1-2,5-7,10-12,19H2;1H |
| InChIKey | CISXMWMWKKTTIB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|