C16H22ClN3O4S — CID 120584972
N-(2-amino-1-cyclopentylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride (PubChem CID 120584972) has the molecular formula C16H22ClN3O4S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120584972 |
| Molecular Formula | C16H22ClN3O4S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)NC(CN)C3CCCC3)cc2C1=O.Cl |
| InChI | InChI=1S/C16H21N3O4S.ClH/c1-19-15(20)12-7-6-11(8-13(12)16(19)21)24(22,23)18-14(9-17)10-4-2-3-5-10;/h6-8,10,14,18H,2-5,9,17H2,1H3;1H |
| InChIKey | XCLAWNLGWUJNRB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|