C16H21N3O4S — CID 119986408
N-[2-(aminomethyl)cyclohexyl]-2-methyl-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 119986408) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-methyl-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-methyl-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 119986408 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-methyl-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)NC3CCCCC3CN)cc2C1=O |
| InChI | InChI=1S/C16H21N3O4S/c1-19-15(20)12-7-6-11(8-13(12)16(19)21)24(22,23)18-14-5-3-2-4-10(14)9-17/h6-8,10,14,18H,2-5,9,17H2,1H3 |
| InChIKey | RBTNZRNEUAMAFT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|