C15H25N3O4S2 — CID 119986083
1-N-[2-(aminomethyl)cyclohexyl]-3-N,3-N-dimethylbenzene-1,3-disulfonamide (PubChem CID 119986083) has the molecular formula C15H25N3O4S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-N-[2-(aminomethyl)cyclohexyl]-3-N,3-N-dimethylbenzene-1,3-disulfonamide.
| Compound Name | 1-N-[2-(aminomethyl)cyclohexyl]-3-N,3-N-dimethylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 119986083 |
| Molecular Formula | C15H25N3O4S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-N-[2-(aminomethyl)cyclohexyl]-3-N,3-N-dimethylbenzene-1,3-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(S(=O)(=O)NC2CCCCC2CN)c1 |
| InChI | InChI=1S/C15H25N3O4S2/c1-18(2)24(21,22)14-8-5-7-13(10-14)23(19,20)17-15-9-4-3-6-12(15)11-16/h5,7-8,10,12,15,17H,3-4,6,9,11,16H2,1-2H3 |
| InChIKey | CAFLBBFMLUQLAD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |