C14H18ClN3O4S — CID 119986962
N-(2-amino-1-cyclopropylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride (PubChem CID 119986962) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119986962 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide;hydrochloride |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)NC(CN)C3CC3)cc2C1=O.Cl |
| InChI | InChI=1S/C14H17N3O4S.ClH/c1-17-13(18)10-5-4-9(6-11(10)14(17)19)22(20,21)16-12(7-15)8-2-3-8;/h4-6,8,12,16H,2-3,7,15H2,1H3;1H |
| InChIKey | WQMJGEXSAVMWCX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|