C13H16N4O4S — CID 119986757
N-(2-amino-1-cyclopropylethyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 119986757) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 119986757 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1ccc2[nH]c(=O)[nH]c(=O)c2c1)C1CC1 |
| InChI | InChI=1S/C13H16N4O4S/c14-6-11(7-1-2-7)17-22(20,21)8-3-4-10-9(5-8)12(18)16-13(19)15-10/h3-5,7,11,17H,1-2,6,14H2,(H2,15,16,18,19) |
| InChIKey | WBIUOQQGQOXMLZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |